C22H27ClO9 — CID 90877256
2-[4-chloro-3-[(4-ethoxyphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 90877256) has the molecular formula C22H27ClO9 and a molecular weight of 470.90 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethoxyphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | 2-[4-chloro-3-[(4-ethoxyphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 90877256 |
| Molecular Formula | C22H27ClO9 |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethoxyphenyl)-dihydroxymethyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | CCOc1ccc(C(O)(O)c2cc(C3(OC)OC(CO)C(O)C(O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO9/c1-3-31-14-7-4-12(5-8-14)21(28,29)15-10-13(6-9-16(15)23)22(30-2)20(27)19(26)18(25)17(11-24)32-22/h4-10,17-20,24-29H,3,11H2,1-2H3 |
| InChIKey | UDHKKPSJGIZXBD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|