C27H37ClO8 — CID 134256507
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-propan-2-yloxymethyl]phenyl]-6-(hydroxymethyl)-2-propan-2-yloxyoxane-3,4,5-triol (PubChem CID 134256507) has the molecular formula C27H37ClO8 and a molecular weight of 525.04 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-propan-2-yloxymethyl]phenyl]-6-(hydroxymethyl)-2-propan-2-yloxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-propan-2-yloxymethyl]phenyl]-6-(hydroxymethyl)-2-propan-2-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 134256507 |
| Molecular Formula | C27H37ClO8 |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)-propan-2-yloxymethyl]phenyl]-6-(hydroxymethyl)-2-propan-2-yloxyoxane-3,4,5-triol |
| SMILES | CCOc1ccc(C(OC(C)C)c2cc([C@]3(OC(C)C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H37ClO8/c1-6-33-19-10-7-17(8-11-19)25(34-15(2)3)20-13-18(9-12-21(20)28)27(35-16(4)5)26(32)24(31)23(30)22(14-29)36-27/h7-13,15-16,22-26,29-32H,6,14H2,1-5H3/t22-,23-,24+,25?,26-,27+/m1/s1 |
| InChIKey | AFHBGBLIPXWDOH-JORCJVEWSA-N |
| XLogP | 3.30 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |