C23H30O6 — CID 56599351
(2R,3R,4S,5S,6S)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol (PubChem CID 56599351) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 56599351 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@]3(C)O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C23H30O6/c1-4-28-18-9-6-15(7-10-18)11-16-12-17(8-5-14(16)2)23(3)22(27)21(26)20(25)19(13-24)29-23/h5-10,12,19-22,24-27H,4,11,13H2,1-3H3/t19-,20+,21-,22+,23+/m0/s1 |
| InChIKey | HUXUDGNEOONSPO-JFDBCFPISA-N |
| XLogP | 1.67 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |