C24H29NO5 — CID 154632673
(5R,6S,7S)-3a-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol (PubChem CID 154632673) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (5R,6S,7S)-3a-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol.
| Compound Name | (5R,6S,7S)-3a-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 154632673 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (5R,6S,7S)-3a-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
| SMILES | CCc1ccc(Cc2cc(C34N=C(C)OC3[C@@H](O)[C@H](O)[C@@H](CO)O4)ccc2C)cc1 |
| InChI | InChI=1S/C24H29NO5/c1-4-16-6-8-17(9-7-16)11-18-12-19(10-5-14(18)2)24-23(29-15(3)25-24)22(28)21(27)20(13-26)30-24/h5-10,12,20-23,26-28H,4,11,13H2,1-3H3/t20-,21-,22+,23?,24?/m1/s1 |
| InChIKey | OHPRXYQGCBTQCJ-JBRXAOCBSA-N |
| XLogP | 2.23 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |