C23H29BrO6 — CID 163770687
(2S,3R,4S,5S)-2-[2-bromo-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 163770687) has the molecular formula C23H29BrO6 and a molecular weight of 481.38 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[2-bromo-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[2-bromo-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 163770687 |
| Molecular Formula | C23H29BrO6 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (2S,3R,4S,5S)-2-[2-bromo-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@]3(OC)OC(CO)[C@@H](O)[C@H](O)[C@H]3O)c(Br)cc2C)cc1 |
| InChI | InChI=1S/C23H29BrO6/c1-4-14-5-7-15(8-6-14)10-16-11-17(18(24)9-13(16)2)23(29-3)22(28)21(27)20(26)19(12-25)30-23/h5-9,11,19-22,25-28H,4,10,12H2,1-3H3/t19?,20-,21+,22-,23+/m1/s1 |
| InChIKey | MGDOLNJGJLUCHD-NQNKTMCVSA-N |
| XLogP | 2.18 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |