C24H29NO6S — CID 163534176
2-[(4-ethylphenyl)methyl]-6-methylsulfanyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile (PubChem CID 163534176) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-6-methylsulfanyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-ethylphenyl)methyl]-6-methylsulfanyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 163534176 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-6-methylsulfanyl-4-[(2S,3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
| SMILES | CCc1ccc(Cc2cc([C@]3(OC)OC(CO)[C@@H](O)[C@H](O)[C@H]3O)cc(SC)c2C#N)cc1 |
| InChI | InChI=1S/C24H29NO6S/c1-4-14-5-7-15(8-6-14)9-16-10-17(11-20(32-3)18(16)12-25)24(30-2)23(29)22(28)21(27)19(13-26)31-24/h5-8,10-11,19,21-23,26-29H,4,9,13H2,1-3H3/t19?,21-,22+,23-,24+/m1/s1 |
| InChIKey | DVOAQTKPOGXVMW-LVCZELDUSA-N |
| XLogP | 1.71 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |