C23H27NO7 — CID 57336134
2-[(4-ethylphenyl)methyl]-6-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile (PubChem CID 57336134) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-6-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile.
| Compound Name | 2-[(4-ethylphenyl)methyl]-6-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 57336134 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-6-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile |
| SMILES | CCc1ccc(Cc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OC)c2C#N)cc1 |
| InChI | InChI=1S/C23H27NO7/c1-3-13-4-6-14(7-5-13)8-15-9-16(10-18(29-2)17(15)11-24)30-23-22(28)21(27)20(26)19(12-25)31-23/h4-7,9-10,19-23,25-28H,3,8,12H2,1-2H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | UIIVKFIPMIIYBH-XNBWIAOKSA-N |
| XLogP | 0.90 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |