C22H28O6 — CID 10293636
(2S,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-6-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10293636) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-6-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-6-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10293636 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-6-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cccc(C)c2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H28O6/c1-3-14-7-9-15(10-8-14)11-16-6-4-5-13(2)21(16)28-22-20(26)19(25)18(24)17(12-23)27-22/h4-10,17-20,22-26H,3,11-12H2,1-2H3/t17-,18-,19+,20-,22+/m1/s1 |
| InChIKey | BXTXNVIPCAPOTF-JPVHLGFFSA-N |
| XLogP | 1.33 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |