C20H23ClO6 — CID 10222285
(2S,3R,4S,5S,6R)-2-[2-[(4-chlorophenyl)methyl]-3-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10222285) has the molecular formula C20H23ClO6 and a molecular weight of 394.85 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[2-[(4-chlorophenyl)methyl]-3-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[2-[(4-chlorophenyl)methyl]-3-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10222285 |
| Molecular Formula | C20H23ClO6 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2-[(4-chlorophenyl)methyl]-3-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClO6/c1-11-3-2-4-15(14(11)9-12-5-7-13(21)8-6-12)26-20-19(25)18(24)17(23)16(10-22)27-20/h2-8,16-20,22-25H,9-10H2,1H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | GIXHJVGFTCHTTC-OUUBHVDSSA-N |
| XLogP | 1.42 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |