C19H21ClO6 — CID 10199816
(2S,3R,4S,5S,6R)-2-(2-benzyl-3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10199816) has the molecular formula C19H21ClO6 and a molecular weight of 380.82 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2-benzyl-3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2-benzyl-3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10199816 |
| Molecular Formula | C19H21ClO6 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2-benzyl-3-chlorophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc(Cl)c2Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21ClO6/c20-13-7-4-8-14(12(13)9-11-5-2-1-3-6-11)25-19-18(24)17(23)16(22)15(10-21)26-19/h1-8,15-19,21-24H,9-10H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | ONZXJBIGFJWLMK-UJWQCDCRSA-N |
| XLogP | 1.11 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |