C32H36O12 — CID 161416255
2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol (PubChem CID 161416255) has the molecular formula C32H36O12 and a molecular weight of 612.63 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 161416255 |
| Molecular Formula | C32H36O12 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol |
| SMILES | OCC1OC(Oc2cccc3ccccc23)C(O)C(O)C1O.OCC1OC(Oc2cccc3ccccc23)C(O)C(O)C1O |
| InChI | InChI=1S/2C16H18O6/c2*17-8-12-13(18)14(19)15(20)16(22-12)21-11-7-3-5-9-4-1-2-6-10(9)11/h2*1-7,12-20H,8H2 |
| InChIKey | VWCWEBNKALAKHF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |