C26H31NO7 — CID 140547288
2-cyclobutyloxy-6-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (PubChem CID 140547288) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is 2-cyclobutyloxy-6-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile.
| Compound Name | 2-cyclobutyloxy-6-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 140547288 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-cyclobutyloxy-6-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| SMILES | CCc1ccc(Cc2cc([C@@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OC3CCC3)c2C#N)cc1 |
| InChI | InChI=1S/C26H31NO7/c1-2-15-6-8-16(9-7-15)10-17-11-18(12-21(20(17)13-27)33-19-4-3-5-19)26(32)25(31)24(30)23(29)22(14-28)34-26/h6-9,11-12,19,22-25,28-32H,2-5,10,14H2,1H3/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | HRBUZVORVYUDMM-WSGIOKLISA-N |
| XLogP | 1.26 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |