C25H31NO7 — CID 66965724
2-[(4-ethylphenyl)methyl]-6-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (PubChem CID 66965724) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-6-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-ethylphenyl)methyl]-6-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 66965724 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-6-propan-2-yloxy-4-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| SMILES | CCc1ccc(Cc2cc([C@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(OC(C)C)c2C#N)cc1 |
| InChI | InChI=1S/C25H31NO7/c1-4-15-5-7-16(8-6-15)9-17-10-18(11-20(19(17)12-26)32-14(2)3)25(31)24(30)23(29)22(28)21(13-27)33-25/h5-8,10-11,14,21-24,27-31H,4,9,13H2,1-3H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | CJZKIGXFXMDESF-RXFVIIJJSA-N |
| XLogP | 1.12 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |