C24H26F3NO10S — CID 143739323
[4-[[2-cyano-4-propan-2-yloxy-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 143739323) has the molecular formula C24H26F3NO10S and a molecular weight of 577.53 g/mol. Its IUPAC name is [4-[[2-cyano-4-propan-2-yloxy-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[2-cyano-4-propan-2-yloxy-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143739323 |
| Molecular Formula | C24H26F3NO10S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | [4-[[2-cyano-4-propan-2-yloxy-5-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)Oc1cc(C#N)c(Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H26F3NO10S/c1-12(2)36-18-9-15(10-28)14(7-13-3-5-16(6-4-13)38-39(34,35)24(25,26)27)8-17(18)23(33)22(32)21(31)20(30)19(11-29)37-23/h3-6,8-9,12,19-22,29-33H,7,11H2,1-2H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | BOEXYFSAOTWIRV-XNBWIAOKSA-N |
| XLogP | 0.78 |
| TPSA | 186.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|