C25H26F3NO11S — CID 87757053
[4-[[2-cyano-4-[(3S)-oxolan-3-yl]oxy-5-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87757053) has the molecular formula C25H26F3NO11S and a molecular weight of 605.54 g/mol. Its IUPAC name is [4-[[2-cyano-4-[(3S)-oxolan-3-yl]oxy-5-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[2-cyano-4-[(3S)-oxolan-3-yl]oxy-5-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87757053 |
| Molecular Formula | C25H26F3NO11S |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | [4-[[2-cyano-4-[(3S)-oxolan-3-yl]oxy-5-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | N#Cc1cc(O[C@H]2CCOC2)c([C@]2(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H26F3NO11S/c26-25(27,28)41(35,36)40-16-3-1-13(2-4-16)7-14-8-18(19(9-15(14)10-29)38-17-5-6-37-12-17)24(34)23(33)22(32)21(31)20(11-30)39-24/h1-4,8-9,17,20-23,30-34H,5-7,11-12H2/t17-,20+,21+,22-,23+,24-/m0/s1 |
| InChIKey | JOHVGVZTOBZSPX-UQDMXIALSA-N |
| XLogP | 0.16 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|