C26H31NO9 — CID 91013258
2-[(4-methoxyphenyl)methyl]-5-(oxolan-3-yloxy)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile (PubChem CID 91013258) has the molecular formula C26H31NO9 and a molecular weight of 501.53 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-5-(oxolan-3-yloxy)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-5-(oxolan-3-yloxy)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 91013258 |
| Molecular Formula | C26H31NO9 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-5-(oxolan-3-yloxy)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]benzonitrile |
| SMILES | COc1ccc(Cc2cc([C@]3(OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC3CCOC3)cc2C#N)cc1 |
| InChI | InChI=1S/C26H31NO9/c1-32-18-5-3-15(4-6-18)9-16-10-20(21(11-17(16)12-27)35-19-7-8-34-14-19)26(33-2)25(31)24(30)23(29)22(13-28)36-26/h3-6,10-11,19,22-25,28-31H,7-9,13-14H2,1-2H3/t19?,22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | VTPICQUJZDHCFQ-IGBUEQETSA-N |
| XLogP | 0.60 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |