C25H29ClO6 — CID 71146786
(2'R,3R,3'S,4'R)-6-chloro-2'-(hydroxymethyl)-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]spiro[1,2-dihydroindene-3,6'-oxane]-3',4'-diol (PubChem CID 71146786) has the molecular formula C25H29ClO6 and a molecular weight of 460.95 g/mol. Its IUPAC name is (2'R,3R,3'S,4'R)-6-chloro-2'-(hydroxymethyl)-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]spiro[1,2-dihydroindene-3,6'-oxane]-3',4'-diol.
| Compound Name | (2'R,3R,3'S,4'R)-6-chloro-2'-(hydroxymethyl)-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]spiro[1,2-dihydroindene-3,6'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 71146786 |
| Molecular Formula | C25H29ClO6 |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (2'R,3R,3'S,4'R)-6-chloro-2'-(hydroxymethyl)-5-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]spiro[1,2-dihydroindene-3,6'-oxane]-3',4'-diol |
| SMILES | OC[C@H]1O[C@]2(CCc3cc(Cl)c(Cc4ccc(O[C@H]5CCOC5)cc4)cc32)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H29ClO6/c26-21-11-16-5-7-25(12-22(28)24(29)23(13-27)32-25)20(16)10-17(21)9-15-1-3-18(4-2-15)31-19-6-8-30-14-19/h1-4,10-11,19,22-24,27-29H,5-9,12-14H2/t19-,22+,23+,24-,25+/m0/s1 |
| InChIKey | OJXKLUKFGODYRD-WQPRPRDESA-N |
| XLogP | 2.74 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |