C24H28O8 — CID 11597448
(3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 11597448) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 11597448 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | OC[C@H]1OC2(OCc3ccc(Cc4ccc(O[C@@H]5CCOC5)cc4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H28O8/c25-11-20-21(26)22(27)23(28)24(32-20)19-10-15(1-4-16(19)12-30-24)9-14-2-5-17(6-3-14)31-18-7-8-29-13-18/h1-6,10,18,20-23,25-28H,7-9,11-13H2/t18-,20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | KWKWRNCMULJIBA-MROGJXICSA-N |
| XLogP | 0.60 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |