C23H26O6 — CID 11516840
(3'R,4'S,5'S,6'R)-5-[(4-cyclopropylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 11516840) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R)-5-[(4-cyclopropylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R)-5-[(4-cyclopropylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 11516840 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (3'R,4'S,5'S,6'R)-5-[(4-cyclopropylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | OC[C@H]1OC2(OCc3ccc(Cc4ccc(C5CC5)cc4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H26O6/c24-11-19-20(25)21(26)22(27)23(29-19)18-10-14(3-6-17(18)12-28-23)9-13-1-4-15(5-2-13)16-7-8-16/h1-6,10,16,19-22,24-27H,7-9,11-12H2/t19-,20-,21+,22-,23?/m1/s1 |
| InChIKey | SCMNAERPQAGSBD-HZQGQDIUSA-N |
| XLogP | 1.31 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |