C13H16O6 — CID 15089071
(3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 15089071) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 15089071 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | OC[C@H]1O[C@]2(OCc3ccccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16O6/c14-5-9-10(15)11(16)12(17)13(19-9)8-4-2-1-3-7(8)6-18-13/h1-4,9-12,14-17H,5-6H2/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | GFGWOLWTPMAXSO-LBELIVKGSA-N |
| XLogP | -1.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |