C21H24O8S — CID 11676456
(3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 11676456) has the molecular formula C21H24O8S and a molecular weight of 436.48 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 11676456 |
| Molecular Formula | C21H24O8S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[(4-methylsulfonylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CS(=O)(=O)c1ccc(Cc2ccc3c(c2)C2(OC3)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H24O8S/c1-30(26,27)15-6-3-12(4-7-15)8-13-2-5-14-11-28-21(16(14)9-13)20(25)19(24)18(23)17(10-22)29-21/h2-7,9,17-20,22-25H,8,10-11H2,1H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | KIZOTBLQMBWOPW-AWGDKMGJSA-N |
| XLogP | -0.16 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |