C22H23ClO7 — CID 45488050
[(1S,3'R,4'S,5'S,6'R)-5-chloro-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[3H-2-benzofuran-1,2'-oxane]-4-yl]-(4-ethylphenyl)methanone (PubChem CID 45488050) has the molecular formula C22H23ClO7 and a molecular weight of 434.87 g/mol. Its IUPAC name is [(1S,3'R,4'S,5'S,6'R)-5-chloro-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[3H-2-benzofuran-1,2'-oxane]-4-yl]-(4-ethylphenyl)methanone.
| Compound Name | [(1S,3'R,4'S,5'S,6'R)-5-chloro-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[3H-2-benzofuran-1,2'-oxane]-4-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 45488050 |
| Molecular Formula | C22H23ClO7 |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [(1S,3'R,4'S,5'S,6'R)-5-chloro-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[3H-2-benzofuran-1,2'-oxane]-4-yl]-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)c2c(Cl)ccc3c2CO[C@]32O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H23ClO7/c1-2-11-3-5-12(6-4-11)18(25)17-13-10-29-22(14(13)7-8-15(17)23)21(28)20(27)19(26)16(9-24)30-22/h3-8,16,19-21,24,26-28H,2,9-10H2,1H3/t16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | XJXAHMPHRVZWNO-OSKXVONFSA-N |
| XLogP | 1.29 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |