C21H22ClFO6 — CID 146912330
(3S,3'R,4'S,5'S)-6-chloro-5-[(4-fluoro-2-methylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 146912330) has the molecular formula C21H22ClFO6 and a molecular weight of 424.85 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S)-6-chloro-5-[(4-fluoro-2-methylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S)-6-chloro-5-[(4-fluoro-2-methylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 146912330 |
| Molecular Formula | C21H22ClFO6 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (3S,3'R,4'S,5'S)-6-chloro-5-[(4-fluoro-2-methylphenyl)methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | Cc1cc(F)ccc1Cc1cc2c(cc1Cl)CO[C@]21OC(CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22ClFO6/c1-10-4-14(23)3-2-11(10)5-12-6-15-13(7-16(12)22)9-28-21(15)20(27)19(26)18(25)17(8-24)29-21/h2-4,6-7,17-20,24-27H,5,8-9H2,1H3/t17?,18-,19+,20-,21+/m1/s1 |
| InChIKey | ABOCVRMZOWDYSN-VKQJQLINSA-N |
| XLogP | 1.54 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |