C24H29FO5 — CID 143617407
(3R,3'S,4'R,5'R)-6-fluoro-2'-(hydroxymethyl)-5'-methyl-5-[(4-propan-2-ylphenyl)methyl]spiro[1H-2-benzofuran-3,6'-oxane]-3',4'-diol (PubChem CID 143617407) has the molecular formula C24H29FO5 and a molecular weight of 416.49 g/mol. Its IUPAC name is (3R,3'S,4'R,5'R)-6-fluoro-2'-(hydroxymethyl)-5'-methyl-5-[(4-propan-2-ylphenyl)methyl]spiro[1H-2-benzofuran-3,6'-oxane]-3',4'-diol.
| Compound Name | (3R,3'S,4'R,5'R)-6-fluoro-2'-(hydroxymethyl)-5'-methyl-5-[(4-propan-2-ylphenyl)methyl]spiro[1H-2-benzofuran-3,6'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 143617407 |
| Molecular Formula | C24H29FO5 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (3R,3'S,4'R,5'R)-6-fluoro-2'-(hydroxymethyl)-5'-methyl-5-[(4-propan-2-ylphenyl)methyl]spiro[1H-2-benzofuran-3,6'-oxane]-3',4'-diol |
| SMILES | CC(C)c1ccc(Cc2cc3c(cc2F)CO[C@]32OC(CO)[C@@H](O)[C@H](O)[C@H]2C)cc1 |
| InChI | InChI=1S/C24H29FO5/c1-13(2)16-6-4-15(5-7-16)8-17-9-19-18(10-20(17)25)12-29-24(19)14(3)22(27)23(28)21(11-26)30-24/h4-7,9-10,13-14,21-23,26-28H,8,11-12H2,1-3H3/t14-,21?,22-,23-,24-/m1/s1 |
| InChIKey | YBTLXWFAOXVNEE-PQDKAXROSA-N |
| XLogP | 2.97 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |