C21H23FO5 — CID 134469353
(3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(4-methylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 134469353) has the molecular formula C21H23FO5 and a molecular weight of 374.41 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(4-methylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(4-methylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 134469353 |
| Molecular Formula | C21H23FO5 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(4-methylphenyl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | Cc1ccc(Cc2cc3c(cc2F)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H23FO5/c1-11-3-5-13(6-4-11)7-14-8-16-15(9-17(14)22)10-26-21(16)20(25)19(24)18(23)12(2)27-21/h3-6,8-9,12,18-20,23-25H,7,10H2,1-2H3/t12-,18-,19+,20-,21+/m1/s1 |
| InChIKey | XOODCLIMVNCPGV-JLBFBPAZSA-N |
| XLogP | 1.91 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |