C24H22ClFO5S — CID 135360408
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360408) has the molecular formula C24H22ClFO5S and a molecular weight of 476.95 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360408 |
| Molecular Formula | C24H22ClFO5S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3cc(Cl)c(Cc4ccc(-c5ccc(F)cc5)s4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22ClFO5S/c1-12-21(27)22(28)23(29)24(31-12)18-9-14(19(25)10-15(18)11-30-24)8-17-6-7-20(32-17)13-2-4-16(26)5-3-13/h2-7,9-10,12,21-23,27-29H,8,11H2,1H3/t12-,21-,22+,23-,24+/m1/s1 |
| InChIKey | QQOVMYTZLNETAE-SQDBCEEMSA-N |
| XLogP | 3.98 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |