C24H23FO5S — CID 163202573
(1R,2S,3S,4R)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 163202573) has the molecular formula C24H23FO5S and a molecular weight of 442.51 g/mol. Its IUPAC name is (1R,2S,3S,4R)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2S,3S,4R)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 163202573 |
| Molecular Formula | C24H23FO5S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (1R,2S,3S,4R)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | Cc1ccc(C23OC[C@@H](O2)[C@@H](O)[C@H](O)[C@H]3O)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C24H23FO5S/c1-13-2-5-16(24-23(28)22(27)21(26)19(30-24)12-29-24)10-15(13)11-18-8-9-20(31-18)14-3-6-17(25)7-4-14/h2-10,19,21-23,26-28H,11-12H2,1H3/t19-,21-,22+,23-,24?/m1/s1 |
| InChIKey | GSYSCFDNSVZDOK-KKEQRHKBSA-N |
| XLogP | 3.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |