C24H25FO2S — CID 118458003
2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-methyloxan-3-ol (PubChem CID 118458003) has the molecular formula C24H25FO2S and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-methyloxan-3-ol.
| Compound Name | 2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 118458003 |
| Molecular Formula | C24H25FO2S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-methyloxan-3-ol |
| SMILES | Cc1ccc(C2OC(C)CCC2O)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C24H25FO2S/c1-15-3-5-18(24-22(26)11-4-16(2)27-24)13-19(15)14-21-10-12-23(28-21)17-6-8-20(25)9-7-17/h3,5-10,12-13,16,22,24,26H,4,11,14H2,1-2H3 |
| InChIKey | OVFRPWCFNHGHJO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |