C26H27FO6S — CID 154630281
[(2S,3S,4R,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 154630281) has the molecular formula C26H27FO6S and a molecular weight of 486.56 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154630281 |
| Molecular Formula | C26H27FO6S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H27FO6S/c1-14-3-4-17(26-25(31)24(30)23(29)21(33-26)13-32-15(2)28)11-18(14)12-20-9-10-22(34-20)16-5-7-19(27)8-6-16/h3-11,21,23-26,29-31H,12-13H2,1-2H3/t21-,23+,24-,25+,26-/m0/s1 |
| InChIKey | RXTZJMBUUNMILB-FYHLHOPESA-N |
| XLogP | 3.54 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |