C33H33NO9S — CID 145075029
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(4-cyanophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate (PubChem CID 145075029) has the molecular formula C33H33NO9S and a molecular weight of 619.69 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(4-cyanophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(4-cyanophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145075029 |
| Molecular Formula | C33H33NO9S |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[5-(4-cyanophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(-c4ccc(C#N)cc4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H33NO9S/c1-18-6-9-25(14-26(18)15-27-12-13-29(44-27)24-10-7-23(16-34)8-11-24)30-32(41-21(4)37)33(42-22(5)38)31(40-20(3)36)28(43-30)17-39-19(2)35/h6-14,28,30-33H,15,17H2,1-5H3/t28-,30+,31-,32+,33+/m1/s1 |
| InChIKey | JVBQLDADVJZNFE-AGLXMARUSA-N |
| XLogP | 4.98 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|