C34H46O10Si — CID 143243003
[(3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate (PubChem CID 143243003) has the molecular formula C34H46O10Si and a molecular weight of 642.82 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 143243003 |
| Molecular Formula | C34H46O10Si |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | [(3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](c2ccc(C)c(Cc3ccc(O[Si](C)(C)C(C)(C)C)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H46O10Si/c1-20-11-14-26(18-27(20)17-25-12-15-28(16-13-25)44-45(9,10)34(6,7)8)30-32(41-23(4)37)33(42-24(5)38)31(40-22(3)36)29(43-30)19-39-21(2)35/h11-16,18,29-33H,17,19H2,1-10H3/t29?,30-,31+,32-,33-/m0/s1 |
| InChIKey | HKCMORNEHRYWEE-KBFMJNBOSA-N |
| XLogP | 5.77 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|