C32H31ClO10S — CID 86601073
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(3-formylphenyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 86601073) has the molecular formula C32H31ClO10S and a molecular weight of 643.11 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(3-formylphenyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(3-formylphenyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86601073 |
| Molecular Formula | C32H31ClO10S |
| Molecular Weight | 643.11 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[5-(3-formylphenyl)thiophen-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4cccc(C=O)c4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H31ClO10S/c1-17(35)39-16-27-30(40-18(2)36)32(42-20(4)38)31(41-19(3)37)29(43-27)23-8-10-26(33)24(13-23)14-25-9-11-28(44-25)22-7-5-6-21(12-22)15-34/h5-13,15,27,29-32H,14,16H2,1-4H3/t27-,29+,30-,31+,32+/m1/s1 |
| InChIKey | VKVZLZNJUZZDHR-IFUGWHCZSA-N |
| XLogP | 5.27 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|