C24H26BrClO7S — CID 58242599
[(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-2-ethyloxan-3-yl] acetate (PubChem CID 58242599) has the molecular formula C24H26BrClO7S and a molecular weight of 573.89 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-2-ethyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-2-ethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58242599 |
| Molecular Formula | C24H26BrClO7S |
| Molecular Weight | 573.89 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-2-ethyloxan-3-yl] acetate |
| SMILES | CC[C@H]1OC(c2ccc(Cl)c(Cc3ccc(Br)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26BrClO7S/c1-5-19-22(30-12(2)27)24(32-14(4)29)23(31-13(3)28)21(33-19)15-6-8-18(26)16(10-15)11-17-7-9-20(25)34-17/h6-10,19,21-24H,5,11H2,1-4H3/t19-,21?,22-,23+,24+/m1/s1 |
| InChIKey | RNSUTYVBHOPQCC-ZJFHNGKCSA-N |
| XLogP | 5.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.89 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|