C33H50BrClO5S — CID 66619879
(3S,5R)-2-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane (PubChem CID 66619879) has the molecular formula C33H50BrClO5S and a molecular weight of 674.18 g/mol. Its IUPAC name is (3S,5R)-2-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane.
| Compound Name | (3S,5R)-2-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
|---|---|
| PubChem CID | 66619879 |
| Molecular Formula | C33H50BrClO5S |
| Molecular Weight | 674.18 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | (3S,5R)-2-[3-[(5-bromothiophen-2-yl)methyl]-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
| SMILES | CCCCOCC1OC(c2ccc(Cl)c(Cc3ccc(Br)s3)c2)C(OCCCC)C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C33H50BrClO5S/c1-5-9-17-36-23-28-31(37-18-10-6-2)33(39-20-12-8-4)32(38-19-11-7-3)30(40-28)24-13-15-27(35)25(21-24)22-26-14-16-29(34)41-26/h13-16,21,28,30-33H,5-12,17-20,22-23H2,1-4H3/t28?,30?,31-,32?,33?/m1/s1 |
| InChIKey | YIJWQUWPMSZRME-LRQFSDCOSA-N |
| XLogP | 9.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.18 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|