C35H53ClN2O6S — CID 70819961
2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]methyl]-5-(2,3-dihydrofuran-5-yl)-1,3,4-thiadiazole (PubChem CID 70819961) has the molecular formula C35H53ClN2O6S and a molecular weight of 665.34 g/mol. Its IUPAC name is 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]methyl]-5-(2,3-dihydrofuran-5-yl)-1,3,4-thiadiazole.
| Compound Name | 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]methyl]-5-(2,3-dihydrofuran-5-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 70819961 |
| Molecular Formula | C35H53ClN2O6S |
| Molecular Weight | 665.34 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]methyl]-5-(2,3-dihydrofuran-5-yl)-1,3,4-thiadiazole |
| SMILES | CCCCOC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3nnc(C4=CCCO4)s3)c2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C35H53ClN2O6S/c1-5-9-17-39-24-29-32(41-18-10-6-2)34(43-20-12-8-4)33(42-19-11-7-3)31(44-29)25-15-16-27(36)26(22-25)23-30-37-38-35(45-30)28-14-13-21-40-28/h14-16,22,29,31-34H,5-13,17-21,23-24H2,1-4H3/t29-,31+,32-,33?,34+/m1/s1 |
| InChIKey | KXPNURMEKCRRAZ-NGIWIOSHSA-N |
| XLogP | 8.36 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.34 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|