C33H46ClNO6S — CID 89494826
1-[(2R,3S,4R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]ethanol (PubChem CID 89494826) has the molecular formula C33H46ClNO6S and a molecular weight of 620.25 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]ethanol.
| Compound Name | 1-[(2R,3S,4R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 89494826 |
| Molecular Formula | C33H46ClNO6S |
| Molecular Weight | 620.25 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 1-[(2R,3S,4R,5S,6S)-3,4,5-tributoxy-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]ethanol |
| SMILES | CCCCOC1[C@@H](OCCCC)[C@H](OCCCC)[C@@H](C(C)O)O[C@H]1c1ccc(Cl)c(Cc2ncc(-c3ccco3)s2)c1 |
| InChI | InChI=1S/C33H46ClNO6S/c1-5-8-15-38-31-29(22(4)36)41-30(32(39-16-9-6-2)33(31)40-17-10-7-3)23-13-14-25(34)24(19-23)20-28-35-21-27(42-28)26-12-11-18-37-26/h11-14,18-19,21-22,29-33,36H,5-10,15-17,20H2,1-4H3/t22?,29-,30+,31-,32?,33+/m1/s1 |
| InChIKey | OYOYHWKWWHLZDR-RLFWVBOLSA-N |
| XLogP | 8.02 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.25 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|