C42H40ClNO6S — CID 67996207
1-[(2R,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol (PubChem CID 67996207) has the molecular formula C42H40ClNO6S and a molecular weight of 722.30 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol.
| Compound Name | 1-[(2R,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 67996207 |
| Molecular Formula | C42H40ClNO6S |
| Molecular Weight | 722.30 g/mol |
| Exact Mass | 721.23 |
| IUPAC Name | 1-[(2R,3S,4R,5S,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol |
| SMILES | CC(O)[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H40ClNO6S/c1-28(45)38-40(47-25-29-12-5-2-6-13-29)42(49-27-31-16-9-4-10-17-31)41(48-26-30-14-7-3-8-15-30)39(50-38)32-19-20-34(43)33(22-32)23-37-44-24-36(51-37)35-18-11-21-46-35/h2-22,24,28,38-42,45H,23,25-27H2,1H3/t28?,38-,39+,40-,41?,42+/m1/s1 |
| InChIKey | CJOUOQCHLOITPW-NSOHWHIKSA-N |
| XLogP | 9.22 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.30 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |