C27H26ClNO8S2 — CID 54769537
methyl 2-[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-4-methylbenzenesulfonate (PubChem CID 54769537) has the molecular formula C27H26ClNO8S2 and a molecular weight of 592.09 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-4-methylbenzenesulfonate.
| Compound Name | methyl 2-[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54769537 |
| Molecular Formula | C27H26ClNO8S2 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | methyl 2-[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-4-methylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(C)cc1[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H26ClNO8S2/c1-14-5-8-21(39(33,34)35-2)17(10-14)27-25(32)23(30)24(31)26(37-27)15-6-7-18(28)16(11-15)12-22-29-13-20(38-22)19-4-3-9-36-19/h3-11,13,23-27,30-32H,12H2,1-2H3/t23-,24-,25+,26+,27-/m1/s1 |
| InChIKey | GMTNWICIWYQBSG-IONQDRQYSA-N |
| XLogP | 4.19 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|