C21H20F3NO6S — CID 53320047
(2S,3R,4R,5S,6R)-2-[3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-(trifluoromethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53320047) has the molecular formula C21H20F3NO6S and a molecular weight of 471.45 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-(trifluoromethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-(trifluoromethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53320047 |
| Molecular Formula | C21H20F3NO6S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-(trifluoromethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(C(F)(F)F)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20F3NO6S/c22-21(23,24)12-4-3-10(20-19(29)18(28)17(27)14(9-26)31-20)6-11(12)7-16-25-8-15(32-16)13-2-1-5-30-13/h1-6,8,14,17-20,26-29H,7,9H2/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | GWMWTMVAPOQIPH-QSWMPLQWSA-N |
| XLogP | 2.53 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |