C28H28BrNO10S — CID 86680890
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-bromo-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 86680890) has the molecular formula C28H28BrNO10S and a molecular weight of 650.50 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-bromo-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-bromo-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86680890 |
| Molecular Formula | C28H28BrNO10S |
| Molecular Weight | 650.50 g/mol |
| Exact Mass | 649.06 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-bromo-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Br)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H28BrNO10S/c1-14(31)36-13-22-26(37-15(2)32)28(39-17(4)34)27(38-16(3)33)25(40-22)18-7-8-20(29)19(10-18)11-24-30-12-23(41-24)21-6-5-9-35-21/h5-10,12,22,25-28H,11,13H2,1-4H3/t22-,25+,26-,27+,28+/m1/s1 |
| InChIKey | SJWCSOGATKUHBI-LSNQXMIESA-N |
| XLogP | 4.55 |
| TPSA | 140.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|