C25H28ClNO8S — CID 140604825
tert-butyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate (PubChem CID 140604825) has the molecular formula C25H28ClNO8S and a molecular weight of 538.02 g/mol. Its IUPAC name is tert-butyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 140604825 |
| Molecular Formula | C25H28ClNO8S |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | tert-butyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H28ClNO8S/c1-25(2,3)35-24(31)33-12-17-20(28)21(29)22(30)23(34-17)13-6-7-15(26)14(9-13)10-19-27-11-18(36-19)16-5-4-8-32-16/h4-9,11,17,20-23,28-30H,10,12H2,1-3H3/t17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | NNHPGUMEWFXCDD-PHNZBSFLSA-N |
| XLogP | 4.12 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |