C20H19ClINO5S — CID 86680892
(2S,3R,4R,5S,6S)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(iodomethyl)oxane-3,4,5-triol (PubChem CID 86680892) has the molecular formula C20H19ClINO5S and a molecular weight of 547.80 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(iodomethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(iodomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 86680892 |
| Molecular Formula | C20H19ClINO5S |
| Molecular Weight | 547.80 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(iodomethyl)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)O[C@H](CI)[C@H]1O |
| InChI | InChI=1S/C20H19ClINO5S/c21-12-4-3-10(20-19(26)18(25)17(24)14(8-22)28-20)6-11(12)7-16-23-9-15(29-16)13-2-1-5-27-13/h1-6,9,14,17-20,24-26H,7-8H2/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | WKSJXBKJQJEFIK-QSWMPLQWSA-N |
| XLogP | 3.60 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|