C28H26ClNO8S — CID 140604830
benzyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate (PubChem CID 140604830) has the molecular formula C28H26ClNO8S and a molecular weight of 572.04 g/mol. Its IUPAC name is benzyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate.
| Compound Name | benzyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 140604830 |
| Molecular Formula | C28H26ClNO8S |
| Molecular Weight | 572.04 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | benzyl [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl carbonate |
| SMILES | O=C(OCc1ccccc1)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccco4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H26ClNO8S/c29-19-9-8-17(11-18(19)12-23-30-13-22(39-23)20-7-4-10-35-20)27-26(33)25(32)24(31)21(38-27)15-37-28(34)36-14-16-5-2-1-3-6-16/h1-11,13,21,24-27,31-33H,12,14-15H2/t21-,24-,25+,26-,27+/m1/s1 |
| InChIKey | DDSXOSUIOYNLNS-TVMVJRKWSA-N |
| XLogP | 4.52 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.04 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |