C26H31ClN2O6S2 — CID 67995538
[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 67995538) has the molecular formula C26H31ClN2O6S2 and a molecular weight of 567.13 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 67995538 |
| Molecular Formula | C26H31ClN2O6S2 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccsc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H31ClN2O6S2/c1-3-13(2)21(28)26(33)34-11-18-22(30)23(31)24(32)25(35-18)14-4-5-17(27)16(8-14)9-20-29-10-19(37-20)15-6-7-36-12-15/h4-8,10,12-13,18,21-25,30-32H,3,9,11,28H2,1-2H3/t13-,18+,21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | XEDICOMBDRBWSS-VFHJTLMESA-N |
| XLogP | 3.56 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |