C25H28ClNO7S2 — CID 54769755
[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl] pentyl carbonate (PubChem CID 54769755) has the molecular formula C25H28ClNO7S2 and a molecular weight of 554.09 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl] pentyl carbonate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl] pentyl carbonate |
|---|---|
| PubChem CID | 54769755 |
| Molecular Formula | C25H28ClNO7S2 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)O[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccsc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H28ClNO7S2/c1-2-3-4-8-32-25(31)34-24-22(30)20(28)21(29)23(33-24)14-5-6-17(26)16(10-14)11-19-27-12-18(36-19)15-7-9-35-13-15/h5-7,9-10,12-13,20-24,28-30H,2-4,8,11H2,1H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | LIFLECWAQSLRDR-URYYLNOGSA-N |
| XLogP | 4.94 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|