C22H23ClN2O4S — CID 52949970
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(2-thiophen-3-ylpyrimidin-5-yl)methyl]phenyl]-6-ethyloxane-3,4,5-triol (PubChem CID 52949970) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(2-thiophen-3-ylpyrimidin-5-yl)methyl]phenyl]-6-ethyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(2-thiophen-3-ylpyrimidin-5-yl)methyl]phenyl]-6-ethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 52949970 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(2-thiophen-3-ylpyrimidin-5-yl)methyl]phenyl]-6-ethyloxane-3,4,5-triol |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3cnc(-c4ccsc4)nc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H23ClN2O4S/c1-2-17-18(26)19(27)20(28)21(29-17)13-3-4-16(23)15(8-13)7-12-9-24-22(25-10-12)14-5-6-30-11-14/h3-6,8-11,17-21,26-28H,2,7H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | RKINBQSFJNTDGP-ADAARDCZSA-N |
| XLogP | 3.38 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |