C28H37NO8 — CID 70907144
[(2R,3S,4R,5R,6S)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2R)-2-amino-3-methylbutanoate (PubChem CID 70907144) has the molecular formula C28H37NO8 and a molecular weight of 515.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 70907144 |
| Molecular Formula | C28H37NO8 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2R)-2-amino-3-methylbutanoate |
| SMILES | CCc1ccc([C@@H]2O[C@H](COC(=O)[C@H](N)C(C)C)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H37NO8/c1-4-17-6-7-18(13-19(17)11-16-5-8-20-21(12-16)35-10-9-34-20)27-26(32)25(31)24(30)22(37-27)14-36-28(33)23(29)15(2)3/h5-8,12-13,15,22-27,30-32H,4,9-11,14,29H2,1-3H3/t22-,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | SUHGYTPTNGVBFO-KDXDQFODSA-N |
| XLogP | 1.66 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |