C24H26O6 — CID 123223286
6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-(hydroxymethyl)-5-methyloxane-3,4-dione (PubChem CID 123223286) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-(hydroxymethyl)-5-methyloxane-3,4-dione.
| Compound Name | 6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-(hydroxymethyl)-5-methyloxane-3,4-dione |
|---|---|
| PubChem CID | 123223286 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-(hydroxymethyl)-5-methyloxane-3,4-dione |
| SMILES | CCc1ccc(C2OC(CO)C(=O)C(=O)C2C)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H26O6/c1-3-16-5-6-17(24-14(2)22(26)23(27)21(13-25)30-24)12-18(16)10-15-4-7-19-20(11-15)29-9-8-28-19/h4-7,11-12,14,21,24-25H,3,8-10,13H2,1-2H3 |
| InChIKey | ZKJSQQMDDBXWOR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|