C24H30O8 — CID 122462078
(2S,3R,4S,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(hydroxymethyl)-6-methyloxane-2,3,4,5-tetrol (PubChem CID 122462078) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(hydroxymethyl)-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(hydroxymethyl)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 122462078 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-6-(hydroxymethyl)-6-methyloxane-2,3,4,5-tetrol |
| SMILES | CCc1ccc([C@]2(O)O[C@](C)(CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H30O8/c1-3-15-5-6-17(24(29)22(28)20(26)21(27)23(2,13-25)32-24)12-16(15)10-14-4-7-18-19(11-14)31-9-8-30-18/h4-7,11-12,20-22,25-29H,3,8-10,13H2,1-2H3/t20-,21-,22+,23+,24-/m0/s1 |
| InChIKey | IOLGGZVNWCWFLX-FCUGFLGKSA-N |
| XLogP | 0.62 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |