C29H36O7 — CID 126595404
[(2R,4S,5R,6S)-5-acetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-ethyl-4-methyloxan-3-yl] acetate (PubChem CID 126595404) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(2R,4S,5R,6S)-5-acetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-ethyl-4-methyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5R,6S)-5-acetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 126595404 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [(2R,4S,5R,6S)-5-acetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-ethylphenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
| SMILES | CCc1ccc([C@@H]2O[C@H](CC)C(OC(C)=O)[C@H](C)[C@H]2OC(C)=O)cc1Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C29H36O7/c1-6-21-9-10-22(16-23(21)14-20-8-11-25-26(15-20)33-13-12-32-25)29-28(35-19(5)31)17(3)27(34-18(4)30)24(7-2)36-29/h8-11,15-17,24,27-29H,6-7,12-14H2,1-5H3/t17-,24+,27?,28+,29-/m0/s1 |
| InChIKey | ZGNVXVLENXZSEC-VQGVDLRPSA-N |
| XLogP | 4.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |